Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Ethyl bromopyruvate, 80-85%
CAS: 70-23-5 Molecular Formula: C5H7BrO3 Molecular Weight (g/mol): 195.01 MDL Number: MFCD00000204 InChI Key: VICYTAYPKBLQFB-UHFFFAOYSA-N Synonym: ethyl bromopyruvate,ethyl 3-bromopyruvate,propanoic acid, 3-bromo-2-oxo-, ethyl ester,bromopyruvic acid ethyl ester,ethyl bromo pyruvate,ethyl 3-bromo-2-oxopropionate,pyruvic acid, bromo-, ethyl ester,.beta.-bromopyruvic acid ethyl ester,3-bromo-2-oxo-propionic acid ethyl ester,beta-bromopyruvic acid ethyl ester PubChem CID: 66144 IUPAC Name: ethyl 3-bromo-2-oxopropanoate SMILES: CCOC(=O)C(=O)CBr
| PubChem CID | 66144 |
|---|---|
| CAS | 70-23-5 |
| Molecular Weight (g/mol) | 195.01 |
| MDL Number | MFCD00000204 |
| SMILES | CCOC(=O)C(=O)CBr |
| Synonym | ethyl bromopyruvate,ethyl 3-bromopyruvate,propanoic acid, 3-bromo-2-oxo-, ethyl ester,bromopyruvic acid ethyl ester,ethyl bromo pyruvate,ethyl 3-bromo-2-oxopropionate,pyruvic acid, bromo-, ethyl ester,.beta.-bromopyruvic acid ethyl ester,3-bromo-2-oxo-propionic acid ethyl ester,beta-bromopyruvic acid ethyl ester |
| IUPAC Name | ethyl 3-bromo-2-oxopropanoate |
| InChI Key | VICYTAYPKBLQFB-UHFFFAOYSA-N |
| Molecular Formula | C5H7BrO3 |
3-Methylstyrene, 95%
CAS: 100-80-1 Molecular Formula: C9H10 Molecular Weight (g/mol): 118.18 InChI Key: JZHGRUMIRATHIU-UHFFFAOYSA-N Synonym: 3-methylstyrene,3-vinyltoluene,1-methyl-3-vinylbenzene,m-vinyltoluene,m-methylstyrene,benzene, 1-ethenyl-3-methyl,styrene, m-methyl,m-methyl styrene,meta-methylstyrene,unii-ffk4i9430g PubChem CID: 7529 IUPAC Name: 1-ethenyl-3-methylbenzene SMILES: CC1=CC=CC(=C1)C=C
| PubChem CID | 7529 |
|---|---|
| CAS | 100-80-1 |
| Molecular Weight (g/mol) | 118.18 |
| SMILES | CC1=CC=CC(=C1)C=C |
| Synonym | 3-methylstyrene,3-vinyltoluene,1-methyl-3-vinylbenzene,m-vinyltoluene,m-methylstyrene,benzene, 1-ethenyl-3-methyl,styrene, m-methyl,m-methyl styrene,meta-methylstyrene,unii-ffk4i9430g |
| IUPAC Name | 1-ethenyl-3-methylbenzene |
| InChI Key | JZHGRUMIRATHIU-UHFFFAOYSA-N |
| Molecular Formula | C9H10 |
6-chloro-1-hexyne, 97%
CAS: 10297-06-0 Molecular Formula: C6H9Cl Molecular Weight (g/mol): 116.59 MDL Number: MFCD00013697 InChI Key: ZUKOCGMVJUXIJA-UHFFFAOYSA-N PubChem CID: 272001 IUPAC Name: 6-chlorohex-1-yne SMILES: ClCCCCC#C
| PubChem CID | 272001 |
|---|---|
| CAS | 10297-06-0 |
| Molecular Weight (g/mol) | 116.59 |
| MDL Number | MFCD00013697 |
| SMILES | ClCCCCC#C |
| IUPAC Name | 6-chlorohex-1-yne |
| InChI Key | ZUKOCGMVJUXIJA-UHFFFAOYSA-N |
| Molecular Formula | C6H9Cl |
Thiocarbohydrazide, 98%
CAS: 2231-57-4 Molecular Formula: CH6N4S Molecular Weight (g/mol): 106.15 MDL Number: MFCD00007616 InChI Key: LJTFFORYSFGNCT-UHFFFAOYSA-N Synonym: thiocarbohydrazide,thiocarbazide,thiocarbonohydrazide,carbonothioic dihydrazide,carbohydrazide, thio,thiocarbonic dihydrazide,1,3-diamino-2-thiourea,hydrazinecarbohydrazonothioic acid,usaf ek-7372,unii-1iz2h82nwu PubChem CID: 2724189 ChEBI: CHEBI:9549 IUPAC Name: 1,3-diaminothiourea SMILES: NNC(=S)NN
| PubChem CID | 2724189 |
|---|---|
| CAS | 2231-57-4 |
| Molecular Weight (g/mol) | 106.15 |
| ChEBI | CHEBI:9549 |
| MDL Number | MFCD00007616 |
| SMILES | NNC(=S)NN |
| Synonym | thiocarbohydrazide,thiocarbazide,thiocarbonohydrazide,carbonothioic dihydrazide,carbohydrazide, thio,thiocarbonic dihydrazide,1,3-diamino-2-thiourea,hydrazinecarbohydrazonothioic acid,usaf ek-7372,unii-1iz2h82nwu |
| IUPAC Name | 1,3-diaminothiourea |
| InChI Key | LJTFFORYSFGNCT-UHFFFAOYSA-N |
| Molecular Formula | CH6N4S |
N,N,N',N'-Tetramethyl-p-phenylenediamine, 98%
CAS: 100-22-1 Molecular Formula: C10H16N2 Molecular Weight (g/mol): 164.25 InChI Key: CJAOGUFAAWZWNI-UHFFFAOYSA-N Synonym: wurster's blue,wurster's reagent,n,n,n',n'-tetramethyl-p-phenylenediamine,n,n,n',n'-tetramethyl-1,4-phenylenediamine,tetramethyl-p-phenylenediamine,1,4-bis dimethylamino benzene,p-bis dimethylamino benzene,1,4-benzenediamine, n,n,n',n'-tetramethyl,benzene, 1,4-bis dimethylamino,unii-p4p3ac32zb PubChem CID: 7490 IUPAC Name: 1-N,1-N,4-N,4-N-tetramethylbenzene-1,4-diamine SMILES: CN(C)C1=CC=C(C=C1)N(C)C
| PubChem CID | 7490 |
|---|---|
| CAS | 100-22-1 |
| Molecular Weight (g/mol) | 164.25 |
| SMILES | CN(C)C1=CC=C(C=C1)N(C)C |
| Synonym | wurster's blue,wurster's reagent,n,n,n',n'-tetramethyl-p-phenylenediamine,n,n,n',n'-tetramethyl-1,4-phenylenediamine,tetramethyl-p-phenylenediamine,1,4-bis dimethylamino benzene,p-bis dimethylamino benzene,1,4-benzenediamine, n,n,n',n'-tetramethyl,benzene, 1,4-bis dimethylamino,unii-p4p3ac32zb |
| IUPAC Name | 1-N,1-N,4-N,4-N-tetramethylbenzene-1,4-diamine |
| InChI Key | CJAOGUFAAWZWNI-UHFFFAOYSA-N |
| Molecular Formula | C10H16N2 |
4-Bromo-3-(trifluoromethyl)-1H-pyrazole, 97%, Thermo Scientific™
CAS: 19968-17-3 Molecular Formula: C4H2BrF3N2 Molecular Weight (g/mol): 214.97 InChI Key: JTHNMRUVJDWVMJ-UHFFFAOYSA-N Synonym: 4-bromo-3-trifluoromethyl-1h-pyrazole,4-bromo-5-trifluoromethyl-1h-pyrazole,1h-pyrazole, 4-bromo-3-trifluoromethyl,1h-pyrazole, 4-bromo-5-trifluoromethyl,1h-pyrazole,4-bromo-3-trifluoromethyl,4-bromo-3-trifluoromethyl pyrazole,4-bromo-3-trifluoromethyl-2h-pyrazole,acmc-209f4m,4-bromo-3 trifluoromethyl-1h-pyrazole PubChem CID: 7147398 IUPAC Name: 4-bromo-5-(trifluoromethyl)-1H-pyrazole SMILES: C1=NNC(=C1Br)C(F)(F)F
| PubChem CID | 7147398 |
|---|---|
| CAS | 19968-17-3 |
| Molecular Weight (g/mol) | 214.97 |
| SMILES | C1=NNC(=C1Br)C(F)(F)F |
| Synonym | 4-bromo-3-trifluoromethyl-1h-pyrazole,4-bromo-5-trifluoromethyl-1h-pyrazole,1h-pyrazole, 4-bromo-3-trifluoromethyl,1h-pyrazole, 4-bromo-5-trifluoromethyl,1h-pyrazole,4-bromo-3-trifluoromethyl,4-bromo-3-trifluoromethyl pyrazole,4-bromo-3-trifluoromethyl-2h-pyrazole,acmc-209f4m,4-bromo-3 trifluoromethyl-1h-pyrazole |
| IUPAC Name | 4-bromo-5-(trifluoromethyl)-1H-pyrazole |
| InChI Key | JTHNMRUVJDWVMJ-UHFFFAOYSA-N |
| Molecular Formula | C4H2BrF3N2 |
4-Chlorocinnamic acid, 99%, predominantly trans
CAS: 1615-02-7 Molecular Formula: C9H7ClO2 Molecular Weight (g/mol): 182.60 MDL Number: MFCD00004396 InChI Key: GXLIFJYFGMHYDY-ZZXKWVIFSA-N Synonym: 4-chlorocinnamic acid,p-chlorocinnamic acid,3-4-chlorophenyl acrylic acid,trans-4-chlorocinnamic acid,2e-3-4-chlorophenyl prop-2-enoic acid,e-p-chlorocinnamic acid,cinnamic acid, p-chloro,trans-p-chlorocinnamic acid,2-propenoic acid, 3-4-chlorophenyl,3-p-chlorophenyl acrylic acid PubChem CID: 637797 ChEBI: CHEBI:61116 IUPAC Name: (E)-3-(4-chlorophenyl)prop-2-enoic acid SMILES: OC(=O)\C=C\C1=CC=C(Cl)C=C1
| PubChem CID | 637797 |
|---|---|
| CAS | 1615-02-7 |
| Molecular Weight (g/mol) | 182.60 |
| ChEBI | CHEBI:61116 |
| MDL Number | MFCD00004396 |
| SMILES | OC(=O)\C=C\C1=CC=C(Cl)C=C1 |
| Synonym | 4-chlorocinnamic acid,p-chlorocinnamic acid,3-4-chlorophenyl acrylic acid,trans-4-chlorocinnamic acid,2e-3-4-chlorophenyl prop-2-enoic acid,e-p-chlorocinnamic acid,cinnamic acid, p-chloro,trans-p-chlorocinnamic acid,2-propenoic acid, 3-4-chlorophenyl,3-p-chlorophenyl acrylic acid |
| IUPAC Name | (E)-3-(4-chlorophenyl)prop-2-enoic acid |
| InChI Key | GXLIFJYFGMHYDY-ZZXKWVIFSA-N |
| Molecular Formula | C9H7ClO2 |
(Trimethylsilyl)methyllithium, 0.7M (10 wt%) solution in hexanes, AcroSeal™
CAS: 1822-00-0 | C4H11LiSi | 94.16 g/mol
| Boiling Point | 65.0°C to 70.0°C |
|---|---|
| Linear Formula | LiCH2Si(CH3)3 |
| Molecular Weight (g/mol) | 94.16 |
| Color | Brown-Yellow to Colorless |
| Physical Form | Solution |
| CAS Min % | 86.0 |
| Chemical Name or Material | (Trimethylsilyl)methyllithium |
| SMILES | [Li+].C[Si](C)(C)[CH2-] |
| InChI Key | KVWLUDFGXDFFON-UHFFFAOYSA-N |
| Density | 0.6500g/mL |
| PubChem CID | 3482579 |
| Name Note | 0.8M (12 wt%) solution in hexanes |
| Percent Purity | 7 to 14 wt% |
| CAS | 92112-69-1 |
| Health Hazard 3 | GHS P Statement Wear eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsi |
| MDL Number | MFCD00010747 |
| Health Hazard 2 | GHS H Statement Highly flammable liquid and vapor. May be fatal if swallowed and enters airways. Causes severe skin burns and eye damage. May cause drowsiness or dizziness. Suspected of damaging fertility. May cause d |
| Flash Point | −40°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | trimethylsilyl methyllithium,trimethylsilyl methyl lithium,lich2sime3,pubchem18144,tms-ch2li,lithiomethyltrimethylsilane,acmc-1bvf0,trimethylsilylmethyl lithium |
| IUPAC Name | lithium;methanidyl(trimethyl)silane |
| Molecular Formula | C4H11LiSi |
| Formula Weight | 94.16 |
| Specific Gravity | 0.65 |
| CAS Max % | 93.0 |
4-Aminophenyl ether, 98%
CAS: 101-80-4 Molecular Formula: C12H12N2O Molecular Weight (g/mol): 200.24 MDL Number: MFCD00007863 InChI Key: HLBLWEWZXPIGSM-UHFFFAOYSA-N Synonym: 4,4'-oxydianiline,4,4'-diaminodiphenyl ether,4,4-oxydianiline,4-aminophenyl ether,4,4'-oxybisbenzenamine,oxydianiline,4-4-aminophenoxy aniline,diaminodiphenyl ether,benzenamine, 4,4'-oxybis,p,p'-oxydianiline PubChem CID: 7579 ChEBI: CHEBI:34384 IUPAC Name: 4-(4-aminophenoxy)aniline SMILES: C1=CC(=CC=C1N)OC2=CC=C(C=C2)N
| PubChem CID | 7579 |
|---|---|
| CAS | 101-80-4 |
| Molecular Weight (g/mol) | 200.24 |
| ChEBI | CHEBI:34384 |
| MDL Number | MFCD00007863 |
| SMILES | C1=CC(=CC=C1N)OC2=CC=C(C=C2)N |
| Synonym | 4,4'-oxydianiline,4,4'-diaminodiphenyl ether,4,4-oxydianiline,4-aminophenyl ether,4,4'-oxybisbenzenamine,oxydianiline,4-4-aminophenoxy aniline,diaminodiphenyl ether,benzenamine, 4,4'-oxybis,p,p'-oxydianiline |
| IUPAC Name | 4-(4-aminophenoxy)aniline |
| InChI Key | HLBLWEWZXPIGSM-UHFFFAOYSA-N |
| Molecular Formula | C12H12N2O |
4-Phenoxybenzoic acid, 98%
CAS: 2215-77-2 Molecular Formula: C13H10O3 Molecular Weight (g/mol): 214.22 MDL Number: MFCD00002539 InChI Key: RYAQFHLUEMJOMF-UHFFFAOYSA-N Synonym: p-phenoxybenzoic acid,benzoic acid, 4-phenoxy,diphenyl ether 4-carboxylic acid,4-phenoxy-benzoic acid,4-carboxybiphenyl ether,4-carboxydiphenyl ether,benzoic acid, p-phenoxy,p-carboxydiphenyl ether,4-phenoxy benzoic acid,4-phoc6h4cooh PubChem CID: 75182 ChEBI: CHEBI:72632 IUPAC Name: 4-phenoxybenzoic acid SMILES: OC(=O)C1=CC=C(OC2=CC=CC=C2)C=C1
| PubChem CID | 75182 |
|---|---|
| CAS | 2215-77-2 |
| Molecular Weight (g/mol) | 214.22 |
| ChEBI | CHEBI:72632 |
| MDL Number | MFCD00002539 |
| SMILES | OC(=O)C1=CC=C(OC2=CC=CC=C2)C=C1 |
| Synonym | p-phenoxybenzoic acid,benzoic acid, 4-phenoxy,diphenyl ether 4-carboxylic acid,4-phenoxy-benzoic acid,4-carboxybiphenyl ether,4-carboxydiphenyl ether,benzoic acid, p-phenoxy,p-carboxydiphenyl ether,4-phenoxy benzoic acid,4-phoc6h4cooh |
| IUPAC Name | 4-phenoxybenzoic acid |
| InChI Key | RYAQFHLUEMJOMF-UHFFFAOYSA-N |
| Molecular Formula | C13H10O3 |
3,4-Dichlorobenzyl bromide, 97%
CAS: 18880-04-1 Molecular Formula: C7H5BrCl2 Molecular Weight (g/mol): 239.93 MDL Number: MFCD00041363 InChI Key: XLWSBDFQAJXCQX-UHFFFAOYSA-N Synonym: 3,4-dichlorobenzyl bromide,4-bromomethyl-1,2-dichlorobenzene,benzene, 4-bromomethyl-1,2-dichloro,3,4-dichlorobenzylbromide,alpha-bromo-3,4-dichlorotoluene,acmc-209erq,3,4 dichlorobenzyl bromide,3,4-dichloro-benzyl bromide,ksc493a6b,timtec-bb sbb005763 PubChem CID: 639726 IUPAC Name: 4-(bromomethyl)-1,2-dichlorobenzene SMILES: C1=CC(=C(C=C1CBr)Cl)Cl
| PubChem CID | 639726 |
|---|---|
| CAS | 18880-04-1 |
| Molecular Weight (g/mol) | 239.93 |
| MDL Number | MFCD00041363 |
| SMILES | C1=CC(=C(C=C1CBr)Cl)Cl |
| Synonym | 3,4-dichlorobenzyl bromide,4-bromomethyl-1,2-dichlorobenzene,benzene, 4-bromomethyl-1,2-dichloro,3,4-dichlorobenzylbromide,alpha-bromo-3,4-dichlorotoluene,acmc-209erq,3,4 dichlorobenzyl bromide,3,4-dichloro-benzyl bromide,ksc493a6b,timtec-bb sbb005763 |
| IUPAC Name | 4-(bromomethyl)-1,2-dichlorobenzene |
| InChI Key | XLWSBDFQAJXCQX-UHFFFAOYSA-N |
| Molecular Formula | C7H5BrCl2 |
(Methoxycarbonylsulfamoyl)triethylammonium hydroxide, 97%, inner salt
CAS: 29684-56-8 Molecular Formula: C8H18N2O4S Molecular Weight (g/mol): 238.30 MDL Number: MFCD00077815 InChI Key: YSHOWEKUVWPFNR-UHFFFAOYSA-N Synonym: methoxycarbonylsulfamoyl triethylammonium hydroxide,burgess reagent,carbomethoxysulfamoyltriethylammonium hydroxide,methoxycarbonylsulfamoyltriethylammonium hydroxide,methoxycarbonylsulphamoyltriethylammonium hydroxide,methoxy-carbonylsulfamoyltriethylammonium hydroxide,methoxycarbonylsulfa-moyl-triethylammonium hydroxide,methoxycarbonylsulphamoyl-triethylammonium hydroxide PubChem CID: 11032497 SMILES: CC[N+](CC)(CC)S(=O)(=O)[N-]C(=O)OC
| PubChem CID | 11032497 |
|---|---|
| CAS | 29684-56-8 |
| Molecular Weight (g/mol) | 238.30 |
| MDL Number | MFCD00077815 |
| SMILES | CC[N+](CC)(CC)S(=O)(=O)[N-]C(=O)OC |
| Synonym | methoxycarbonylsulfamoyl triethylammonium hydroxide,burgess reagent,carbomethoxysulfamoyltriethylammonium hydroxide,methoxycarbonylsulfamoyltriethylammonium hydroxide,methoxycarbonylsulphamoyltriethylammonium hydroxide,methoxy-carbonylsulfamoyltriethylammonium hydroxide,methoxycarbonylsulfa-moyl-triethylammonium hydroxide,methoxycarbonylsulphamoyl-triethylammonium hydroxide |
| InChI Key | YSHOWEKUVWPFNR-UHFFFAOYSA-N |
| Molecular Formula | C8H18N2O4S |
4-Chloro-2-phenylquinoline, 99%
CAS: 4979-79-7 Molecular Formula: C15H10ClN Molecular Weight (g/mol): 239.71 MDL Number: MFCD00160641 InChI Key: GLVDSTVYOFXBKT-UHFFFAOYSA-N Synonym: 4-chloro-2-phenyl-quinoline,4-chloro-2-phenyquinoline,2-phenyl-4-chloroquinoline,4-chloro-2-phenyl-quinolin,4-chloro-2-phenyl quinoline PubChem CID: 278376 IUPAC Name: 4-chloro-2-phenylquinoline SMILES: C1=CC=C(C=C1)C2=NC3=CC=CC=C3C(=C2)Cl
| PubChem CID | 278376 |
|---|---|
| CAS | 4979-79-7 |
| Molecular Weight (g/mol) | 239.71 |
| MDL Number | MFCD00160641 |
| SMILES | C1=CC=C(C=C1)C2=NC3=CC=CC=C3C(=C2)Cl |
| Synonym | 4-chloro-2-phenyl-quinoline,4-chloro-2-phenyquinoline,2-phenyl-4-chloroquinoline,4-chloro-2-phenyl-quinolin,4-chloro-2-phenyl quinoline |
| IUPAC Name | 4-chloro-2-phenylquinoline |
| InChI Key | GLVDSTVYOFXBKT-UHFFFAOYSA-N |
| Molecular Formula | C15H10ClN |
Tri-(2-furyl)phosphine, 98%
CAS: 5518-52-5 Molecular Formula: C12H9O3P Molecular Weight (g/mol): 232.18 MDL Number: MFCD00151857 InChI Key: DLQYXUGCCKQSRJ-UHFFFAOYSA-N Synonym: tri 2-furyl phosphine,tri furan-2-yl phosphine,tri-2-furyl phosphine,tris furan-2-yl phosphane,tri-2-furylphosphine,tris 2-furyl phosphine,tri furan-2-yl phosphane,trifurylphosphine,tri fur-2-yl phosphane,tris 2-furanyl phosphine PubChem CID: 521585 IUPAC Name: tris(furan-2-yl)phosphane SMILES: O1C=CC=C1P(C1=CC=CO1)C1=CC=CO1
| PubChem CID | 521585 |
|---|---|
| CAS | 5518-52-5 |
| Molecular Weight (g/mol) | 232.18 |
| MDL Number | MFCD00151857 |
| SMILES | O1C=CC=C1P(C1=CC=CO1)C1=CC=CO1 |
| Synonym | tri 2-furyl phosphine,tri furan-2-yl phosphine,tri-2-furyl phosphine,tris furan-2-yl phosphane,tri-2-furylphosphine,tris 2-furyl phosphine,tri furan-2-yl phosphane,trifurylphosphine,tri fur-2-yl phosphane,tris 2-furanyl phosphine |
| IUPAC Name | tris(furan-2-yl)phosphane |
| InChI Key | DLQYXUGCCKQSRJ-UHFFFAOYSA-N |
| Molecular Formula | C12H9O3P |
1-Chloro-6-hydroxyhexane, 95%
CAS: 2009-83-8 Molecular Formula: C6H13ClO Molecular Weight (g/mol): 136.62 MDL Number: MFCD00002984 InChI Key: JNTPTNNCGDAGEJ-UHFFFAOYSA-N Synonym: 6-chloro-1-hexanol,6-chlorohexanol,1-chloro-6-hydroxyhexane,1-hexanol, 6-chloro,hexamethylene chlorohydrin,1-chloro-6-hexanol,omega-chlorohexanol,unii-t2hit6n5uf,6-chloro-hexanol,t2hit6n5uf PubChem CID: 74828 IUPAC Name: 6-chlorohexan-1-ol SMILES: C(CCCCl)CCO
| PubChem CID | 74828 |
|---|---|
| CAS | 2009-83-8 |
| Molecular Weight (g/mol) | 136.62 |
| MDL Number | MFCD00002984 |
| SMILES | C(CCCCl)CCO |
| Synonym | 6-chloro-1-hexanol,6-chlorohexanol,1-chloro-6-hydroxyhexane,1-hexanol, 6-chloro,hexamethylene chlorohydrin,1-chloro-6-hexanol,omega-chlorohexanol,unii-t2hit6n5uf,6-chloro-hexanol,t2hit6n5uf |
| IUPAC Name | 6-chlorohexan-1-ol |
| InChI Key | JNTPTNNCGDAGEJ-UHFFFAOYSA-N |
| Molecular Formula | C6H13ClO |